Home
Products
Irigenin
| Product Name | Irigenin |
| Price: | $131 / 20mg |
| Catalog No.: | CN04840 |
| CAS No.: | 548-76-5 |
| Molecular Formula: | C18H16O8 |
| Molecular Weight: | 360.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Belamcanda chinensis (L.) DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1OC)O)c1coc2c(c1=O)c(O)c(c(c2)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Irigenin is a is a lead compound, and mediates its anti-metastatic effect by specifically and selectively blocking α9β1 and α4β1 integrins binding sites on C-C loop of Extra Domain A (EDA). Irigenin shows anti-cancer properties. It sensitizes TRAIL-induced apoptosis via enhancing pro-apoptotic molecules in gastric cancer cells[1]. |
| In Vitro | Irigenin specifically targets α9β1 and α4β1 integrin binding sites on Extra Domain A (EDA) comprising LEU46, PHE47, PRO48, GLU58, LEU59 and GLN60 in its C-C loop. Irigenin binds to the C-C loop of EDA, thereby blocking its interaction with integrins on the cell surface and thus abrogating subsequent Epithelial-Mesenchymal transition[1]. |
| Density | 1.461g/cm3 |
| Boiling Point | 646.1ºC at 760mmHg |
| Flash Point | 237.7ºC |
| Exact Mass | 360.08500 |
| PSA | 118.59000 |
| LogP | 2.60260 |
| Storage condition | 2-8C |