Home
Products
Jujuboside B
| Product Name | Jujuboside B |
| Price: | $92 / 20mg |
| Catalog No.: | CN08004 |
| CAS No.: | 55466-05-2 |
| Molecular Formula: | C52H84O21 |
| Molecular Weight: | 1045.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The seeds of Ziziphus jujuba |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)CO[C@H]([C@@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC[C@H]3[C@@]42CO[C@]2(C4)[C@@H]3[C@@](C)(O)C[C@@H](O2)C=C(C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Jujuboside B is one of the major bioactive constituents isolated from Zizyphus jujuba. Jujuboside B can inhibit platelet aggregation[1]. |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 1044.550537 |
| PSA | 314.83000 |
| LogP | 7.53 |