Home
Products
D-Tyrosine
| Product Name | D-Tyrosine |
| Price: | Inquiry |
| Catalog No.: | CN00678 |
| CAS No.: | 556-02-5 |
| Molecular Formula: | C9H11NO3 |
| Molecular Weight: | 181.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@@H](Cc1ccc(cc1)O)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-Tyrosine is the D-isomer of tyrosine. D-Tyrosine negatively regulates melanin synthesis by inhibiting tyrosinase activity. D-Tyrosine inhibits biofilm formation and trigger the self-dispersal of biofilms without suppressing bacterial growth[1][2]. |
| Target | Tyrosinase[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 385.2±32.0 °C at 760 mmHg |
| Flash Point | 186.7±25.1 °C |
| Exact Mass | 181.073898 |
| PSA | 83.55000 |
| LogP | 0.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |