Home
Products
Theophylline
| Product Name | Theophylline |
| Price: | $15 / 50mg |
| Catalog No.: | CN02152 |
| CAS No.: | 58-55-9 |
| Molecular Formula: | C7H8N4O2 |
| Molecular Weight: | 180.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White cryst. |
| Source: | The leaves of Black tea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cn1c(=O)n(C)c2c(c1=O)[nH]cn2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Theophylline is a nonselective phosphodiesterase (PDE) inhibitor, adenosine receptor blocker, and histone deacetylase (HDAC) activator. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 454.1±37.0 °C at 760 mmHg |
| Flash Point | 228.4±26.5 °C |
| Exact Mass | 180.064728 |
| PSA | 72.68000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8°C |