Home
Products
Saikosaponin B2
| Product Name | Saikosaponin B2 |
| Price: | $117 / 20mg |
| Catalog No.: | CN08127 |
| CAS No.: | 58316-41-9 |
| Molecular Formula: | C42H68O13 |
| Molecular Weight: | 780.98 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Bupleurum chinense DC. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(O)C(OC(C2O)C)OC2CCC3(C(C2(C)CO)CCC2(C3C=CC3=C4CC(C)(C)CCC4(C(CC23C)O)CO)C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Saikosaponin B2 is an active component from Bupleurum kaoi root, acts as an entry inhibitor against HCV infection[1]. Anti-cancer activity[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 909.9±65.0 °C at 760 mmHg |
| Flash Point | 504.1±34.3 °C |
| Exact Mass | 780.466003 |
| PSA | 218.99000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |