Home
Products
Monotropein
| Product Name | Monotropein |
| Price: | $62 / 20mg |
| Catalog No.: | CN03177 |
| CAS No.: | 5945-50-6 |
| Molecular Formula: | C16H22O11 |
| Molecular Weight: | 390.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Morinda officinalis How. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@](O)(CO)C=C3)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Monotropein is an iridoid glycoside isolated Morinda officinalis. Monotropein inhibits the expression of inflammatory mediators in dextran sulfate sodium (DSS)-induced colitis mouse model[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 717.6±60.0 °C at 760 mmHg |
| Flash Point | 262.0±26.4 °C |
| Exact Mass | 390.116211 |
| PSA | 186.37000 |
| LogP | -4.43 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |