Home
Products
Soyasapogenol B
| Product Name | Soyasapogenol B |
| Price: | $161 / 5mg |
| Catalog No.: | CN07892 |
| CAS No.: | 595-15-3 |
| Molecular Formula: | C30H50O3 |
| Molecular Weight: | 458.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@]1(C)[C@@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C[C@H]1O)(C)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Soyasapogenol B, an ingredient of soybean, exerts anti-proliferative, anti-metastatic activities. Soyasapogenol B triggers endoplasmic reticulum stress, which mediates apoptosis and autophagy in colorectal cancer[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 555.5±50.0 °C at 760 mmHg |
| Flash Point | 226.6±24.7 °C |
| Exact Mass | 458.376007 |
| PSA | 60.69000 |
| LogP | 7.41 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |