Home
Products
O-Desmethyl galanthamine
| Product Name | O-Desmethyl galanthamine |
| Price: | Inquiry |
| Catalog No.: | CN00060 |
| CAS No.: | 60755-80-8 |
| Molecular Formula: | C16H19NO3 |
| Molecular Weight: | 273.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Lycoris radiata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1C=C[C@@]23[C@H](C1)Oc1c3c(ccc1O)CN(CC2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | O-Desmethyl Galanthamine (Sanguinine) is galanthamine-type alkaloid. O-Desmethyl Galanthamine is an acetylcholinesterase (AChE) inhibitor, with an IC50 1.83 μM[1]. |
| Target | AChE[1] |
| Density | 1.37g/cm3 |
| Boiling Point | 451.9ºC at 760 mmHg |
| Flash Point | 227.1ºC |
| Exact Mass | 273.13600 |
| PSA | 52.93000 |
| LogP | 1.48520 |