Home
Products
Sipeimine
| Product Name | Sipeimine |
| Price: | $92 / 20mg |
| Catalog No.: | CN02173 |
| CAS No.: | 61825-98-7 |
| Molecular Formula: | C27H43NO3 |
| Molecular Weight: | 429.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbus of Fritillaria thunbergii Miq. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1)C(=O)C[C@@H]1[C@@H]2C[C@@H]2[C@H]1CC[C@@H]1[C@H]2CN2C[C@@H](C)CC[C@H]2[C@@]1(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sipeimine is a natural product isolated from Fritillaria ussuriensis.IC50 value:Target:In vitro: Sipeimine can induce rejuvenation of a endophytic fungus; Sipeimine yield of the strain rejuvenated by adding 3% bulbus was effectively improved to 0.0563 mg/L and it is 21.9% higher than that of the initial strain [1].In vivo: |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 567.1±50.0 °C at 760 mmHg |
| Flash Point | 296.8±30.1 °C |
| Exact Mass | 429.324280 |
| PSA | 60.77000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | 2-8°C |