Home
Products
Beta-boswellic acid
| Product Name | Beta-boswellic acid |
| Price: | $234 / 10mg |
| Catalog No.: | CN07811 |
| CAS No.: | 631-69-6 |
| Molecular Formula: | C30H48O3 |
| Molecular Weight: | 456.70 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Boswellia carterii Birdw. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@]2([C@@H]([C@H]1C)C1=CC[C@H]3[C@@]([C@@]1(CC2)C)(C)CCC1[C@]3(C)CC[C@H]([C@]1(C)C(=O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Boswellic acid is isolated from the gum resin of Boswellia serrate.β-Boswellic acid is a nonreducing-type inhibitor of the 5-lipoxygenase (5-LO) product formation either interacting directly with the 5-LO or blocking its translocation[1]. β-Boswellic acid inhibits the synthesis of DNA, RNA and protein in human leukemia HL-60 cells[2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 556.0±50.0 °C at 760 mmHg |
| Flash Point | 304.1±26.6 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 9.38 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Storage condition | 2-8°C |