Home
Products
Lithospermoside
| Product Name | Lithospermoside |
| Price: | $83 / 20mg |
| Catalog No.: | CN02148 |
| CAS No.: | 63492-69-3 |
| Molecular Formula: | C14H19NO8 |
| Molecular Weight: | 329.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Lithospermum officinale. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | N#C/C=C1/C=C[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lithospermoside (Griffonin) is a nature product isolated from the stem bark of Ochna schweinfurthiana F. Hoffm[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 662.4±55.0 °C at 760 mmHg |
| Flash Point | 354.4±31.5 °C |
| Exact Mass | 329.111053 |
| PSA | 163.63000 |
| LogP | -3.58 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Storage condition | 2-8C |