Home
Products
beta-Amyrone
| Product Name | beta-Amyrone |
| Price: | Inquiry |
| Catalog No.: | CN07884 |
| CAS No.: | 638-97-1 |
| Molecular Formula: | C30H48O |
| Molecular Weight: | 424.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Cyclocarya paliums. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 488.3±45.0 °C at 760 mmHg |
| Flash Point | 202.8±23.7 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 10.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |