Home
Products
Pinoresinol diglucoside
| Product Name | Pinoresinol diglucoside |
| Price: | $58 / 20mg |
| Catalog No.: | CN02960 |
| CAS No.: | 63902-38-5 |
| Molecular Formula: | C32H42O16 |
| Molecular Weight: | 682.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2OC)[C@H]2OC[C@H]3[C@@H]2CO[C@@H]3c2ccc(c(c2)OC)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinoresinol Diglucoside is one of the major lignans with various pharmacological activities which could be isolated from Duzhong and other plant species. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 917.3±65.0 °C at 760 mmHg |
| Flash Point | 508.6±34.3 °C |
| Exact Mass | 682.247314 |
| PSA | 235.68000 |
| LogP | -2.92 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |