Home
Products
Taraxasterol acetate
| Product Name | Taraxasterol acetate |
| Price: | $117 / 10mg |
| Catalog No.: | CN07883 |
| CAS No.: | 6426-43-3 |
| Molecular Formula: | C32H52O2 |
| Molecular Weight: | 468.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Inula britannica L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1CCC2(C(C1(C)C)CCC1(C2CCC2C1(C)CCC1(C2C(C)C(=C)CC1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Taraxasteryl acetate is isolated from P. sagittalis,and has a broad spectrum of anti-inflammatory activity. Taraxasteryl acetate relieves dextran, zymosan and arachidonic acid induced rat hind-paw edema. Taraxasteryl acetate can be used for the topical inflammation treatment[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 502.8±19.0 °C at 760 mmHg |
| Flash Point | 254.8±9.0 °C |
| Exact Mass | 468.396729 |
| PSA | 26.30000 |
| LogP | 11.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |