Home
Products
6-Hydroxy-1,2,3,7-tetramethoxyxanthone
| Product Name | 6-Hydroxy-1,2,3,7-tetramethoxyxanthone |
| Price: | Inquiry |
| Catalog No.: | CN05737 |
| CAS No.: | 64756-87-2 |
| Molecular Formula: | C17H16O7 |
| Molecular Weight: | 332.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala sibirica L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1O)oc1c(c2=O)c(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 332.09000 |
| PSA | 87.36000 |
| LogP | 2.68620 |