Home
Products
5,7-Diacetoxyflavone
| Product Name | 5,7-Diacetoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05268 |
| CAS No.: | 6665-78-7 |
| Molecular Formula: | C19H14O6 |
| Molecular Weight: | 338.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barkS of Oroxylum indicum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1cc(OC(=O)C)c2c(c1)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 518.9±50.0 °C at 760 mmHg |
| Flash Point | 230.1±30.2 °C |
| Exact Mass | 338.079041 |
| PSA | 82.81000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |