Home
Products
Trifolirhizin
| Product Name | Trifolirhizin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05264 |
| CAS No.: | 6807-83-6 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)OC[C@@H]2[C@H]3Oc3c2cc2c(c3)OCO2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Trifolirhizin is a pterocarpan flavonoid isolated from the roots of Sophora flavescens. Trifolirhizin possesses potent tyrosinase inhibitory activity with an IC50 of 506 μM[1]. Trifolirhizin exhibits potential anti-inflammatory and anticancer activities[2]. |
| Target | IC50: 506 μM (tyrosinase)[1] |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 658.7±55.0 °C at 760 mmHg |
| Flash Point | 352.2±31.5 °C |
| Exact Mass | 446.121307 |
| PSA | 136.30000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | ?20°C |