Home
Products
Roburic acid
| Product Name | Roburic acid |
| Price: | $117 / 20mg |
| Catalog No.: | CN07941 |
| CAS No.: | 6812-81-3 |
| Molecular Formula: | C30H48O2 |
| Molecular Weight: | 440.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Gentiana macrophylla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)CC[C@@]1(C)[C@@H](CC[C@@]2([C@@H]1CC=C1[C@@]2(C)CC[C@@]2([C@H]1[C@@H](C)[C@H](C)CC2)C)C)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Roburic acid, a tetracyclic triterpenoid found in Gentiana macrophylla, acts as an inhibitor of COX, with IC50s of 5 and 9 μM for COX-1 and COX-2, respectively[1]. |
| Target | COX-1:5 μM (IC50) COX-2:9 μM (IC50) |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 528.5±49.0 °C at 760 mmHg |
| Flash Point | 424.9±25.0 °C |
| Exact Mass | 440.365417 |
| PSA | 37.30000 |
| LogP | 11.09 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |