Home
Products
Sempervirine
| Product Name | Sempervirine |
| Price: | Inquiry |
| Catalog No.: | CN01629 |
| CAS No.: | 6882-99-1 |
| Molecular Formula: | C19H16N2 |
| Molecular Weight: | 272.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Gelsemium elegans |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C1CCc2c(C1)cc1[n+](c2)ccc2c1[nH]c1c2cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.28g/cm3 |
| Boiling Point | 591.6ºC at 760 mmHg |
| Flash Point | 311.6ºC |
| Exact Mass | 272.131348 |
| PSA | 17.30000 |
| LogP | 4.51950 |