Home
Products
Bayogenin
| Product Name | Bayogenin |
| Price: | $176 / 20mg |
| Catalog No.: | CN07776 |
| CAS No.: | 6989-24-8 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.70 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The tubers of Bolbostemma paniculatum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@@H](O)[C@@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bayogenin is an alfalfa saponin, shows moderate potency of glycogen phosphorylase inhibition[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 606.0±55.0 °C at 760 mmHg |
| Flash Point | 334.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Storage condition | 2-8℃ |