Home
Products
Phlorizin dihydrate
| Product Name | Phlorizin dihydrate |
| Price: | Inquiry |
| Catalog No.: | CN05663 |
| CAS No.: | 7061-54-3 |
| Molecular Formula: | C21H24O10.2H2O |
| Molecular Weight: | 472.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The herbs of Prunus armeniaca L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc(c2C(=O)CCc2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O.O.O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phlorizin (dihydrate) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Boiling Point | 770ºC at 760 mmHg |
| Flash Point | 270.7ºC |
| Exact Mass | 472.158081 |
| PSA | 195.60000 |