Home
Products
Acetylursolic acid
| Product Name | Acetylursolic acid |
| Price: | $103 / 5mg |
| Catalog No.: | CN07869 |
| CAS No.: | 7372-30-7 |
| Molecular Formula: | C32H50O4 |
| Molecular Weight: | 498.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ilex paraguariensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1CC[C@]2(C(C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@H](C)CC1)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ursolic acid acetate (Acetylursolic acid), isolated from the aerial roots of Ficus microcarpa, exhibits cytotoxicity against KB cells with IC50 of 8.4 μM[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 597.8±50.0 °C at 760 mmHg |
| Flash Point | 329.3±26.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 8.43 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |