Home
Products
Methylophiopogonone A
| Product Name | Methylophiopogonone A |
| Price: | $293 / 5mg |
| Catalog No.: | CN04889 |
| CAS No.: | 74805-90-6 |
| Molecular Formula: | C19H16O6 |
| Molecular Weight: | 340.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Ophiopogon japonicus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1c(O)c(C)c2c(c1O)c(=O)c(co2)Cc1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methylophiopogonone A, a homoisoflavonoid isolated from the tuberous roots of Ophiopogon japonicas, shows anti-inflammatory activity[1]. |
| Density | 1.454±0.06 g/cm3 |
| Boiling Point | 573.6±50.0 °C at 760 mmHg |
| Flash Point | 211.3±23.6 °C |
| Exact Mass | 340.094696 |
| PSA | 89.13000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |