Home
Products
Obacunone
| Product Name | Obacunone |
| Price: | $55 / 20mg |
| Catalog No.: | CN07866 |
| CAS No.: | 751-03-1 |
| Molecular Formula: | C26H30O7 |
| Molecular Weight: | 454.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Phellodendron chinense. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=C[C@]2([C@H](C(O1)(C)C)CC(=O)[C@@]1([C@@H]2CC[C@@]2([C@]31O[C@@H]3C(=O)O[C@H]2c1ccoc1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Obacunone, isolated from seeds of Marsh White grapefruit, exhibits anti-tumor activity by the induction of apoptosis[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 626.2±55.0 °C at 760 mmHg |
| Flash Point | 332.5±31.5 °C |
| Exact Mass | 454.199158 |
| PSA | 95.34000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2~8℃ |