Home
Products
(20R)-Protopanaxdiol
| Product Name | (20R)-Protopanaxdiol |
| Price: | $103 / 20mg |
| Catalog No.: | CN08025 |
| CAS No.: | 7755-01-3 |
| Molecular Formula: | C30H52O3 |
| Molecular Weight: | 460.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@]([C@H]1CC[C@]2([C@@H]1[C@H](O)C[C@H]1[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)(O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (20R)-Protopanaxadiol is a triterpenoid saponin metabolite of 20(R)-ginsenoside Rg3 in black ginseng. (20R)-Protopanaxadiol exhibits anti-tumor activity and cytotoxicity, and potently inhibits the growth of Helicobacter pylori[1][2][3]. |
| Density | 1.036 g/cm3 |
| Boiling Point | 559.5ºC at 760 mmHg |
| Flash Point | 226.1ºC |
| Exact Mass | 460.39200 |
| PSA | 60.69000 |
| LogP | 6.50060 |
| Storage condition | 2-8°C |