Home
Products
Ingenol-5,20-acetonide
| Product Name | Ingenol-5,20-acetonide |
| Price: | $234 / 5mg |
| Catalog No.: | CN08497 |
| CAS No.: | 77573-43-4 |
| Molecular Formula: | C23H32O5 |
| Molecular Weight: | 388.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@]23C([C@H]1O)(O)[C@@H]1OC(C)(C)OCC1=C[C@H](C3=O)[C@H]1[C@@H](C[C@H]2C)C1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ingenol-5,20-acetonide is an intermediate from ingenol for synthesis of ingenoids; improved stability compared to ingenol. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 531.4±50.0 °C at 760 mmHg |
| Flash Point | 180.5±23.6 °C |
| Exact Mass | 388.224976 |
| PSA | 75.99000 |
| LogP | 4.24 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8℃ |