Home
Products
4-Hydroxyisoleucine
| Product Name | 4-Hydroxyisoleucine |
| Price: | Inquiry |
| Catalog No.: | CN02170 |
| CAS No.: | 781658-23-9 |
| Molecular Formula: | C6H13NO3 |
| Molecular Weight: | 147.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seeds of Trigonella foenum-graecum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC([C@@H]([C@@H](C(=O)O)N)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4-Hydroxyisoleucine (4-Hydroxy-L-isoleucine) is an amino acid which can be extracted and purified from fenugreek seeds. 4-Hydroxyisoleucine (4-Hydroxy-L-isoleucine) displays an insulinotropic activity of great interest[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 331.6±32.0 °C at 760 mmHg |
| Flash Point | 154.4±25.1 °C |
| Exact Mass | 147.089539 |
| PSA | 83.55000 |
| LogP | -0.44 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |