Home
Products
Stevenleaf
| Product Name | Stevenleaf |
| Price: | $234 / 10mg |
| Catalog No.: | CN08109 |
| CAS No.: | 80321-63-7 |
| Molecular Formula: | C47H80O17 |
| Molecular Weight: | 917.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herb of Gynostemma pentaphyllum (Thunb.) Makino |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@H]3[C@@](O[C@@H]2O[C@H](CO[C@@H]3OC[C@H]([C@@H]([C@@H]3O)O)O)[C@H]([C@@H]([C@@H]2O)O)O)(CCC=C(C)C)C)C)C)[C@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gynostemma Extract is a natural product. |
| Density | 1.36 |
| Exact Mass | 916.54000 |
| PSA | 277.91000 |
| LogP | 0.61230 |
| Storage condition | -20°C |