Home
Products
Rhmannioside D
| Product Name | Rhmannioside D |
| Price: | $100 / 20mg |
| Catalog No.: | CN03120 |
| CAS No.: | 81720-08-3 |
| Molecular Formula: | C27H42O20 |
| Molecular Weight: | 686.61 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@]23C=CO[C@H]([C@@H]3C(=C[C@H]2O)CO)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rehmannioside D is a carotenoid glycoside. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1052.4±65.0 °C at 760 mmHg |
| Flash Point | 590.3±34.3 °C |
| Exact Mass | 686.226929 |
| PSA | 327.60000 |
| LogP | -5.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |