Home
Products
Hydroxy-alpha-sanshool
| Product Name | Hydroxy-alpha-sanshool |
| Price: | $176 / 20mg |
| Catalog No.: | CN00714 |
| CAS No.: | 83883-10-7 |
| Molecular Formula: | C16H25NO2 |
| Molecular Weight: | 263.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Zanthoxylum bungeanum Maxim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C/C=C/C=CCC/C=C/C(=O)NCC(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroxy-α-sanshool is an alkylamide isolated from pepper, acts as a TRPA1 covalent and TRPV1 non-covalent agonist, with EC50s of 69 and 1.1 µM, respectively[1]. |
| Target | EC50: 69 µM (TRPA1), 1.1 µM (TRPV1)[1] |
| Density | 0.973 g/cm3 |
| Boiling Point | 471.5±45.0℃ at 760 mmHg |
| Exact Mass | 263.18900 |
| PSA | 49.33000 |
| LogP | 3.28930 |
| Storage condition | 2-8℃ |