Home
Products
Astragaloside I
| Product Name | Astragaloside I |
| Price: | $77 / 20mg |
| Catalog No.: | CN08112 |
| CAS No.: | 84680-75-1 |
| Molecular Formula: | C45H72O16 |
| Molecular Weight: | 869.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Astragalus membranaceus (Fisch.) Bunge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@H]3[C@]4(C)C[C@@H]([C@@H]([C@@]4(C)CC[C@]43[C@@]3([C@@H]2C(C)(C)[C@H](CC3)O[C@@H]2OC[C@H]([C@@H]([C@H]2OC(=O)C)OC(=O)C)O)C4)[C@@]2(C)CC[C@H](O2)C(O)(C)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Astragaloside I is a natural product isolated from Astragalus. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 910.6±65.0 °C at 760 mmHg |
| Flash Point | 265.5±27.8 °C |
| PSA | 240.36000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |