Home
Products
alpha-Amyrin acetate
| Product Name | alpha-Amyrin acetate |
| Price: | Inquiry |
| Catalog No.: | CN07849 |
| CAS No.: | 863-76-3 |
| Molecular Formula: | C32H52O2 |
| Molecular Weight: | 468.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ervatamia divaricata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1CCC2(C(C1(C)C)CCC1(C2CC=C2C1(C)CCC1(C2C(C)C(C)CC1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Amyrin acetate, a natural triterpenoid, has anti-inflammatory activity, antispasmodic profile and the relaxant effect[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 508.0±50.0 °C at 760 mmHg |
| Flash Point | 258.0±17.7 °C |
| Exact Mass | 468.396729 |
| PSA | 26.30000 |
| LogP | 11.90 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |