Home
Products
Astrasieversianin VII
| Product Name | Astrasieversianin VII |
| Price: | $234 / 10mg |
| Catalog No.: | CN07568 |
| CAS No.: | 86764-11-6 |
| Molecular Formula: | C43H70O15 |
| Molecular Weight: | 827.01 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Astragalus membranaceus (Fisch.) Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@@H]3[C@]4([C@@]5([C@@H]2C(C)(C)[C@H](CC5)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)OC(=O)C)O)C4)CC[C@]2([C@@]3(C)C[C@@H]([C@@H]2[C@@]2(C)CC[C@H](O2)C(O)(C)C)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoastragaloside II is an astragaloside, which is isolated from the hairy root culture of Astragalus membranaceus. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 905.4±65.0 °C at 760 mmHg |
| Flash Point | 264.0±27.8 °C |
| Exact Mass | 826.471497 |
| PSA | 234.29000 |
| LogP | 1.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | -20°C |