Home
Products
Notoginsenoside Fa
| Product Name | Notoginsenoside Fa |
| Price: | $190 / 20mg |
| Catalog No.: | CN07508 |
| CAS No.: | 88100-04-3 |
| Molecular Formula: | C59H100O27 |
| Molecular Weight: | 1241.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax notoginseng. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(COC3OC(CO)C(C(C3O)O)O)C(C(C2O)O)O)(CCC=C(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1OC1CCC(C(C1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Notoginsenoside Fa, a protopanaxadiol (ppd)-type saponin isolated from P. notoginseng, could possibly activate and recover the function of degenerated brain[1][2]. |
| Density | 1.48±0.1 g/cm3 |
| Exact Mass | 1240.65000 |
| PSA | 436.21000 |