Home
Products
Mogroside V
| Product Name | Mogroside V |
| Price: | $46 / 20mg |
| Catalog No.: | CN08053 |
| CAS No.: | 88901-36-4 |
| Molecular Formula: | C60H102O29 |
| Molecular Weight: | 1287.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Siraitia grosvenorii Swingle. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O[C@@H](C(O)(C)C)CC[C@H]([C@H]2CC[C@@]3([C@]2(C)C[C@@H](O)[C@@]2([C@H]3CC=C3[C@H]2CC[C@@H](C3(C)C)O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mogroside V, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogroside V is nearly 300 times sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities. Mogrosides are sweeter than sucrose[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1286.650635 |
| PSA | 476.67000 |
| LogP | -1.07 |