Home
Products
Ophiopogonin C
| Product Name | Ophiopogonin C |
| Price: | Inquiry |
| Catalog No.: | CN02532 |
| CAS No.: | 911819-08-4 |
| Molecular Formula: | C46H72O17 |
| Molecular Weight: | 897.06 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Ophiopogon japonicus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC1CCC2(OC1)OC1C(C2C)C2(C(C1)C1CC=C3C(C1CC2)(C)C(CC(C3)OC(=O)C)OC1OC(C)C(C(C1OC1OC(C)C(C(C1O)O)O)OC1OCC(C(C1O)O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ophiopojaponin C is a naturally occurring C29 steroidal glycoside isolated from the tubers of O. japonicas[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 886.456238 |
| PSA | 276.14000 |
| LogP | 4.77 |