Home
Products
Licoflavone B
| Product Name | Licoflavone B |
| Price: | $497 / 10mg |
| Catalog No.: | CN04500 |
| CAS No.: | 91433-17-9 |
| Molecular Formula: | C25H26O4 |
| Molecular Weight: | 390.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza inflata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc2c(=O)cc(oc2cc1O)c1ccc(c(c1)CC=C(C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoflavone B is a flavonoid isolated from Glycyrrhiza inflata, inhibits S. mansoni ATPase (IC50, 23.78 µM) and ADPase (IC50, 31.50 µM) activity. Anti-schistosomiasis activity[1]. |
| Target | IC50: 23.78 µM (S. mansoni ATPase), 31.50 µM (S. mansoni ADPase)[1] |
| Density | 1.191±0.06 g/cm3(Predicted) |
| Boiling Point | 593.9±50.0 °C(Predicted) |