Home
Products
Clinodiside A
| Product Name | Clinodiside A |
| Price: | $62 / 10mg |
| Catalog No.: | CN08047 |
| CAS No.: | 916347-31-4 |
| Molecular Formula: | C48H78O19 |
| Molecular Weight: | 959.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Clinopodium chinense(Benth) Q.Kuntze |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(OC3CCC4(C(C3)C(C)(CO)CC3(C4C=CC4=C5CC(C)(C)CCC5(C(CC34C)O)CO)C)C)C(C(C2OC2OC(CO)C(C(C2O)O)O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Clinodiside A is isolated from the Chinese medicinal herb Clinopodium chinensis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1054.2±65.0 °C at 760 mmHg |
| Flash Point | 591.3±34.3 °C |
| Exact Mass | 942.518799 |
| PSA | 318.37000 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |