Home
Products
Gypenoside XLIX
| Product Name | Gypenoside XLIX |
| Price: | $71 / 10mg |
| Catalog No.: | CN08089 |
| CAS No.: | 94987-08-3 |
| Molecular Formula: | C52H86O21 |
| Molecular Weight: | 1047.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Gynostemma pentaphyllum (Thunb.) Makino. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@@]([C@H]2CC[C@@]3([C@@H]2CC[C@H]2[C@@]3(C)CC[C@@H]3[C@]2(C=O)CC[C@@H](C3(C)C)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)O)C)(CCC=C(C)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gypenoside XLIX, a dammarane-type glycoside, is a prominent component of G. pentaphyllum. Gypenoside XLIX is a selective peroxisome proliferator-activated receptor (PPAR)-alpha activator and inhibits cytokine-induced vascular cell adhesion molecule-1 (VCAM-1) overexpression and hyperactivity in human endothelial cells[1]. |
| Target | PPAR-α |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1105.1±65.0 °C at 760 mmHg |
| Flash Point | 306.9±27.8 °C |
| Exact Mass | 1046.566162 |
| PSA | 333.67000 |
| LogP | 5.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |