Home
Products
Momordin Ic
| Product Name | Momordin Ic |
| Price: | $69 / 20mg |
| Catalog No.: | CN08087 |
| CAS No.: | 96990-18-0 |
| Molecular Formula: | C41H64O13 |
| Molecular Weight: | 764.93 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Brown powder |
| Source: | The fruits of Kochia scoparia (L.) Schrad. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)C1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC=C3C2(C)CCC2(C3CC(C)(C)CC2)C(=O)O)C)C)C(C(C1O)OC1OCC(C(C1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Momordin Ic is a principal saponin constituent of Fructus Kochiae, with with anti-cancer bioactivity. Momordin Ic induces apoptosis through oxidative stress-regulated mitochondrial dysfunction[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 886.2±65.0 °C at 760 mmHg |
| Flash Point | 263.1±27.8 °C |
| Exact Mass | 764.434692 |
| PSA | 212.67000 |
| LogP | 9.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |