Home
Products
Picfeltarraenin IA
| Product Name | Picfeltarraenin IA |
| Price: | Inquiry |
| Catalog No.: | CN08048 |
| CAS No.: | 97230-47-2 |
| Molecular Formula: | C41H62O13 |
| Molecular Weight: | 762.92 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Picria felterrae Lour. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(C1=CC(=O)C(O1)(C)C1C(O)CC2(C1(C)CC(=O)C1(C2CC=C2C1CCC(C2(C)C)OC1OCC(C(C1OC1OC(C)C(C(C1O)O)O)O)O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Picfeltarraenin IA, a triterpenoid obtained from Picriafel-terrae Lour (P.fel-terrae), is an acetylcholinesterase (AChE) inhibitor. Picfeltarraenin IA can be used for the treatment of herpes infections, cancer and inflammation[1]. |
| Target | AChE[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 861.5±65.0 °C at 760 mmHg |
| Flash Point | 255.3±27.8 °C |
| Exact Mass | 762.419067 |
| PSA | 201.67000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |