Home
Products
Pseudoginsenoside RT5
| Product Name | Pseudoginsenoside RT5 |
| Price: | $234 / 10mg |
| Catalog No.: | CN08027 |
| CAS No.: | 98474-78-3 |
| Molecular Formula: | C36H62O10 |
| Molecular Weight: | 654.88 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@@]3(C)[C@]4(C)CC[C@@H]([C@H]4[C@@H](C[C@@H]3[C@@]3([C@@H]2C(C)(C)[C@@H](O)CC3)C)O)[C@]2(C)CC[C@@H](O2)C(O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudoginsenoside RT5 is isolated from Panax quinquefolium[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 759.5±60.0 °C at 760 mmHg |
| Flash Point | 413.1±32.9 °C |
| Exact Mass | 654.434326 |
| PSA | 169.30000 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±5.8 mmHg at 25°C |
| Storage condition | 2-8C |